CymitQuimica logo

CAS 116668-48-5

:

2,6-Dimethyl-2,5-octadiene

Description:
2,6-Dimethyl-2,5-octadiene is an organic compound characterized by its structure, which features a long carbon chain with two methyl groups and two double bonds. This diene belongs to the class of hydrocarbons known as alkenes, specifically conjugated dienes due to the alternating double bonds. The presence of the double bonds contributes to its reactivity, making it a potential candidate for various chemical reactions, including polymerization and addition reactions. The compound is typically colorless to pale yellow and may have a distinct odor. Its physical properties, such as boiling point and melting point, are influenced by the molecular structure and the presence of the double bonds. 2,6-Dimethyl-2,5-octadiene is used in organic synthesis and may serve as an intermediate in the production of more complex molecules. Safety data indicates that, like many organic compounds, it should be handled with care, as it may be flammable and potentially harmful if inhaled or ingested.
Formula:C10H18
InChI:InChI=1S/C10H18/c1-5-10(4)8-6-7-9(2)3/h7-8H,5-6H2,1-4H3
InChI key:InChIKey=LQJJRPLOVQYMPJ-UHFFFAOYSA-N
SMILES:C(=CCC=C(C)C)(CC)C
Synonyms:
  • 2,5-Octadiene, 2,6-dimethyl-
  • 2,6-Dimethyl-2,5-octadiene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.