CAS 116668-76-9
:2,3,5-Pyridinetricarboxylic acid
Description:
2,3,5-Pyridinetricarboxylic acid, also known as 2,3,5-pyridinetricarboxylic acid, is an organic compound characterized by its pyridine ring structure with three carboxylic acid functional groups attached at the 2, 3, and 5 positions. This compound is typically a white to off-white crystalline solid, soluble in water and polar organic solvents, which enhances its utility in various chemical applications. It exhibits acidic properties due to the presence of carboxylic acid groups, making it a potential candidate for chelation and coordination chemistry, particularly in the formation of metal complexes. The compound may also demonstrate biological activity, which could be explored for pharmaceutical applications. Its CAS number, 116668-76-9, allows for precise identification in chemical databases. Overall, 2,3,5-Pyridinetricarboxylic acid is of interest in both synthetic and applied chemistry due to its multifunctional nature and potential reactivity.
Formula:C8H5NO6
InChI:InChI=1S/C8H5NO6/c10-6(11)3-1-4(7(12)13)5(8(14)15)9-2-3/h1-2H,(H,10,11)(H,12,13)(H,14,15)
InChI key:InChIKey=NVONKHVIUAWOAO-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C(O)=O)N=CC(C(O)=O)=C1
Synonyms:- 2,3,5-Pyridinetricarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
