CymitQuimica logo

CAS 116673-45-1

:

BIS-(3,4,5-TRIMETHOXYPHENYL)-1,3-DIOXOLANE

Description:
BIS-(3,4,5-TRIMETHOXYPHENYL)-1,3-DIOXOLANE, identified by its CAS number 116673-45-1, is an organic compound characterized by its unique dioxolane structure, which features a five-membered ring containing two oxygen atoms. This compound is notable for its two 3,4,5-trimethoxyphenyl groups, which contribute to its chemical stability and potential reactivity. The presence of multiple methoxy groups enhances its solubility in organic solvents and may influence its electronic properties, making it of interest in various chemical applications, including organic synthesis and materials science. Additionally, the compound may exhibit interesting biological activities due to its structural features, although specific biological data may vary. Its synthesis typically involves multi-step organic reactions, and it is essential to handle it with care, adhering to safety protocols, as with many organic compounds. Overall, BIS-(3,4,5-TRIMETHOXYPHENYL)-1,3-DIOXOLANE represents a fascinating subject for research in both synthetic and applied chemistry.
Formula:C21H26O8
InChI:InChI=1/C21H26O8/c1-22-14-7-12(8-15(23-2)19(14)26-5)18-11-28-21(29-18)13-9-16(24-3)20(27-6)17(10-13)25-4/h7-10,18,21H,11H2,1-6H3/t18-,21+/m0/s1
Synonyms:
  • Trans-Btp Dioxolane
  • (+/-) Trans-2,5-Bis(3,4,5-Trimethoxyphenyl)-1,3-Dioxolane
  • Trans-(+/-)-2,4-Bis(3,4,5-Trimethoxyphenyl)-1,3-Dioxolane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.