CAS 116673-46-2
:1-(3,4,5-Trimethoxyphenyl)-1,2-ethanediol
Description:
1-(3,4,5-Trimethoxyphenyl)-1,2-ethanediol, with CAS number 116673-46-2, is an organic compound characterized by its structure, which features a phenolic ring substituted with three methoxy groups and a diol functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of multiple methoxy groups enhances its solubility in organic solvents and may influence its reactivity and biological activity. The diol functional group suggests the potential for hydrogen bonding, which can affect its physical properties such as melting and boiling points. Additionally, the compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its synthesis often involves multi-step organic reactions, and it may be used in various applications, including as an intermediate in the synthesis of more complex molecules or in research settings to explore its biological effects. Safety data should be consulted for handling and usage guidelines.
Formula:C11H16O5
InChI:InChI=1S/C11H16O5/c1-14-9-4-7(8(13)6-12)5-10(15-2)11(9)16-3/h4-5,8,12-13H,6H2,1-3H3
InChI key:InChIKey=VRYUDXCGWXDNLR-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C=C(C(CO)O)C=C1OC
Synonyms:- 1,2-Ethanediol, 1-(3,4,5-trimethoxyphenyl)-
- 1,2-Dihydroxy-1-(3,4,5-trimethoxyphenyl)ethane
- 1-(3,4,5-Trimethoxyphenyl)-1,2-ethanediol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
