CAS 116673-95-1
:5-Benzyl-3,4-dihydro-3,3-dimethyl-2H-pyrrole
Description:
5-Benzyl-3,4-dihydro-3,3-dimethyl-2H-pyrrole, identified by its CAS number 116673-95-1, is an organic compound characterized by its unique pyrrole structure, which features a five-membered nitrogen-containing ring. This compound exhibits a dihydro configuration, indicating the presence of two hydrogen atoms that contribute to its saturation. The benzyl group attached to the pyrrole ring enhances its aromatic properties and may influence its reactivity and solubility. The presence of two methyl groups at the 3-position contributes to steric hindrance, potentially affecting its chemical behavior and interactions. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing more complex molecules. Its stability, reactivity, and solubility in different solvents can vary based on the specific conditions and functional groups present. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C13H17N
InChI:InChI=1/C13H17N/c1-13(2)9-12(14-10-13)8-11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3
SMILES:CC1(C)CC(=NC1)Cc1ccccc1
Synonyms:- 2H-pyrrole, 3,4-dihydro-3,3-dimethyl-5-(phenylmethyl)-
- 5-Benzyl-3,3-dimethyl-3,4-dihydro-2H-pyrrole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
