CAS 1166756-76-8
:Ethyl 3-(5-ethyl-1,2,4-oxadiazol-3-yl)benzoate
Description:
Ethyl 3-(5-ethyl-1,2,4-oxadiazol-3-yl)benzoate is a chemical compound characterized by its unique structure, which includes an ethyl ester functional group and a 1,2,4-oxadiazole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the oxadiazole moiety may impart specific biological activities, making it of interest for research in medicinal chemistry. Ethyl 3-(5-ethyl-1,2,4-oxadiazol-3-yl)benzoate is likely to be a solid or liquid at room temperature, depending on its molecular weight and intermolecular interactions. Its solubility can vary in different solvents, which is crucial for its application in synthesis and formulation. Additionally, the compound's stability, reactivity, and potential toxicity would need to be evaluated in the context of its intended use. Overall, this compound represents a fascinating example of how structural features can influence chemical behavior and potential applications.
Formula:C13H14N2O3
InChI:InChI=1S/C13H14N2O3/c1-3-11-14-12(15-18-11)9-6-5-7-10(8-9)13(16)17-4-2/h5-8H,3-4H2,1-2H3
InChI key:InChIKey=YKLAIEJAARWSHQ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=C(C=CC1)C=2N=C(CC)ON2
Synonyms:- Ethyl 3-(5-ethyl-1,2,4-oxadiazol-3-yl)benzoate
- Benzoic acid, 3-(5-ethyl-1,2,4-oxadiazol-3-yl)-, ethyl ester
- 3-(5-ethyl-1,2,4-oxadiazol-3-yl)Benzoic acid ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ethyl 3-(5-Ethyl-1,2,4-oxadiazol-3-yl)benzoate
CAS:<p>Ethyl 3-(5-Ethyl-1,2,4-oxadiazol-3-yl)benzoate</p>Molecular weight:246.26g/mol

