CAS 1166756-79-1
:Ethyl 4-(5-ethyl-1,2,4-oxadiazol-3-yl)benzoate
Description:
Ethyl 4-(5-ethyl-1,2,4-oxadiazol-3-yl)benzoate is a chemical compound characterized by its unique structure, which includes an ethyl ester group and a 1,2,4-oxadiazole moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the oxadiazole ring. The oxadiazole group can impart biological activity, making this compound of interest in medicinal chemistry and material science. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The presence of the ethyl group may enhance lipophilicity, influencing its interaction with biological systems. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, Ethyl 4-(5-ethyl-1,2,4-oxadiazol-3-yl)benzoate represents a versatile compound with potential applications across various fields of chemistry.
Formula:C13H14N2O3
InChI:InChI=1S/C13H14N2O3/c1-3-11-14-12(15-18-11)9-5-7-10(8-6-9)13(16)17-4-2/h5-8H,3-4H2,1-2H3
InChI key:InChIKey=RXBBQPDZTKGQBD-UHFFFAOYSA-N
SMILES:C(C)C1=NC(=NO1)C2=CC=C(C(OCC)=O)C=C2
Synonyms:- Benzoic acid, 4-(5-ethyl-1,2,4-oxadiazol-3-yl)-, ethyl ester
- Ethyl 4-(5-ethyl-1,2,4-oxadiazol-3-yl)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ethyl 4-(5-Ethyl-1,2,4-oxadiazol-3-yl)benzoate
CAS:Ethyl 4-(5-Ethyl-1,2,4-oxadiazol-3-yl)benzoate
Molecular weight:246.26g/mol

