CAS 1166756-80-4
:Ethyl 3-(5-methyl-1,2,4-oxadiazol-3-yl)benzoate
Description:
Ethyl 3-(5-methyl-1,2,4-oxadiazol-3-yl)benzoate is a chemical compound characterized by its unique structure, which includes an ethyl ester group and a 1,2,4-oxadiazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical and agrochemical research. The presence of the oxadiazole ring suggests possible applications in medicinal chemistry, particularly due to its ability to participate in various chemical reactions and interactions. Additionally, the benzoate portion of the molecule may contribute to its stability and reactivity. The compound's molecular structure can influence its physical properties, such as melting and boiling points, as well as its reactivity with other chemical species. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, due to potential toxicity or reactivity. Overall, Ethyl 3-(5-methyl-1,2,4-oxadiazol-3-yl)benzoate represents a versatile compound with potential applications in various fields of chemistry.
Formula:C12H12N2O3
InChI:InChI=1S/C12H12N2O3/c1-3-16-12(15)10-6-4-5-9(7-10)11-13-8(2)17-14-11/h4-7H,3H2,1-2H3
InChI key:InChIKey=OKGFHGDXEFYTRK-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=C(C=CC1)C=2N=C(C)ON2
Synonyms:- Benzoic acid, 3-(5-methyl-1,2,4-oxadiazol-3-yl)-, ethyl ester
- Ethyl 3-(5-methyl-1,2,4-oxadiazol-3-yl)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
