CymitQuimica logo

CAS 1166756-86-0

:

Methyl 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)benzoate

Description:
Methyl 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)benzoate is a chemical compound characterized by its unique structure, which includes a benzoate moiety and a cyclopropyl-substituted oxadiazole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the oxadiazole functional group. The cyclopropyl group may impart distinctive steric and electronic effects, influencing the compound's reactivity and interactions with biological targets. Methyl 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)benzoate may be of interest in medicinal chemistry and materials science due to its potential biological activity and applications in drug development. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvent used. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound represents a fascinating intersection of organic chemistry and potential therapeutic applications.
Formula:C13H12N2O3
InChI:InChI=1S/C13H12N2O3/c1-17-13(16)10-6-2-8(3-7-10)11-14-12(18-15-11)9-4-5-9/h2-3,6-7,9H,4-5H2,1H3
InChI key:InChIKey=OGWVZWUDZHFDFL-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC=C(C=2N=C(ON2)C3CC3)C=C1
Synonyms:
  • Benzoic acid, 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-, methyl ester
  • Methyl 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.