CAS 1166756-88-2
:Ethyl 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)benzoate
Description:
Ethyl 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)benzoate is a chemical compound characterized by its unique structure, which includes an ethyl ester group and a 1,2,4-oxadiazole ring fused with a cyclopropyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the oxadiazole moiety. The cyclopropyl group may impart distinctive steric and electronic effects, influencing the compound's reactivity and interaction with biological targets. Ethyl 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)benzoate may be of interest in medicinal chemistry for its potential pharmacological activities, as oxadiazoles are often explored for their biological properties. Additionally, the compound's structure suggests potential applications in materials science or as a building block in organic synthesis. However, specific data regarding its physical properties, such as melting point, boiling point, and spectral characteristics, would require further investigation or experimental determination.
Formula:C14H14N2O3
InChI:InChI=1S/C14H14N2O3/c1-2-18-14(17)11-7-3-9(4-8-11)12-15-13(19-16-12)10-5-6-10/h3-4,7-8,10H,2,5-6H2,1H3
InChI key:InChIKey=YUKRBJVOIXTABL-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC=C(C=2N=C(ON2)C3CC3)C=C1
Synonyms:- Ethyl 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)benzoate
- Benzoic acid, 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
