CAS 116696-66-3
:BENZYL 2-ACETAMIDO-4,6-O-BENZYLIDENE-2-DEOXY-3-O-METHYL-ALPHA-D-GLUCOPYRANOSIDE
Description:
Benzyl 2-acetamido-4,6-O-benzylidene-2-deoxy-3-O-methyl-alpha-D-glucopyranoside is a complex glycoside derivative characterized by its structural components, which include a glucopyranoside backbone modified with various functional groups. This compound features an acetamido group, which contributes to its solubility and reactivity, and multiple benzylidene groups that enhance its stability and may influence its biological activity. The presence of a methoxy group at the 3-position of the glucopyranoside adds to its chemical diversity. This compound is typically used in biochemical research and may exhibit specific interactions with biological macromolecules, making it of interest in medicinal chemistry. Its synthesis often involves multi-step organic reactions, highlighting its complexity. The compound's properties, such as solubility, melting point, and reactivity, can vary based on the conditions under which it is synthesized and stored. As with many glycosides, it may also exhibit specific enzymatic activities or inhibitory effects, which can be explored in pharmacological studies.
Formula:C23H27NO6
InChI:InChI=1/C23H27NO6/c1-15(25)24-19-21(26-2)20-18(14-28-22(30-20)17-11-7-4-8-12-17)29-23(19)27-13-16-9-5-3-6-10-16/h3-12,18-23H,13-14H2,1-2H3,(H,24,25)/t18?,19-,20+,21+,22?,23+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
α-D-Glucopyranoside, phenylmethyl 2-(acetylamino)-2-deoxy-3-O-methyl-4,6-O-(phenylmethylene)-
CAS:Formula:C23H27NO6Color and Shape:SolidMolecular weight:413.4636Benzyl 2-acetamido-4,6-O-benzylidene-2-deoxy-3-O-methyl-α-D-glucopyranoside
CAS:Molecular weight:413.46Benzyl 2-acetamido-4,6-O-benzylidene-2-deoxy-3-O-methyl-a-D-glucopyranoside
CAS:<p>Benzyl 2-acetamido-4,6-O-benzylidene-2-deoxy-3-O-methyl-aDglucopyranoside is a synthetic oligosaccharide with a complex carbohydrate structure. It is custom synthesized by glycosylation and polysaccharide modification to produce a high purity product. Click chemistry modifications, methylations, and fluorination are used for the synthesis of benzyl 2-acetamido-4,6-Obenzylidene -2deoxy -3OmethylaDglucopyranoside. The CAS number for this product is 116696–66–3.</p>Formula:C23H27NO6Purity:Min. 95%Molecular weight:413.46 g/mol


