CymitQuimica logo

CAS 116696-68-5

:

Hexuronic acid, 4-deoxy-5-keto-

Description:
Hexuronic acid, 4-deoxy-5-keto- (CAS 116696-68-5) is a chemical compound characterized by its unique structural features, which include a hexuronic acid backbone with specific modifications at the 4 and 5 positions. This compound typically exhibits acidic properties due to the presence of carboxylic acid functional groups, which can participate in various chemical reactions, including esterification and salt formation. Its keto group at the 5-position contributes to its reactivity and potential interactions with other biomolecules. Hexuronic acids are often involved in biological processes, particularly in the metabolism of carbohydrates and polysaccharides. The presence of hydroxyl groups in its structure may also enhance its solubility in water and its ability to form hydrogen bonds. Overall, hexuronic acid derivatives are of interest in biochemistry and pharmaceutical research due to their potential roles in cellular functions and their applications in drug development and therapeutic interventions.
Formula:C6H8O6
InChI:InChI=1S/C6H8O6/c7-2-5(10)3(8)1-4(9)6(11)12/h2-3,5,8,10H,1H2,(H,11,12)
InChI key:InChIKey=IMUGYKFHMJLTOU-UHFFFAOYSA-N
SMILES:C(CC(C(O)=O)=O)(C(C=O)O)O
Synonyms:
  • Hexuronic acid, 4-deoxy-5-keto-
  • 4-Deoxy-5-keto-hexuronic acid
  • Hexuronic acid, 4-deoxy-5-keto- (6CI)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.