CAS 1166994-78-0
:Dicyclohexyl[9,10-dihydro-12-(2-methoxyphenyl)-9,10-ethenoanthracen-11-yl]phosphine
Description:
Dicyclohexyl[9,10-dihydro-12-(2-methoxyphenyl)-9,10-ethenoanthracen-11-yl]phosphine is a phosphine compound characterized by its complex structure, which includes a phosphine functional group attached to a polycyclic aromatic system. This compound features a dicyclohexyl substituent, contributing to its steric bulk and potentially influencing its reactivity and solubility. The presence of the 2-methoxyphenyl group enhances its electronic properties, making it suitable for various applications in organic synthesis and catalysis. The ethylene bridge in the anthracene framework introduces unique electronic characteristics, which may facilitate interactions with other chemical species. Additionally, the compound's phosphine moiety can act as a ligand in coordination chemistry, forming complexes with transition metals. Its stability, reactivity, and solubility in organic solvents are important factors for its practical applications. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior, making it a subject of interest in advanced materials and organometallic chemistry.
Formula:C35H39OP
InChI:InChI=1S/C35H39OP/c1-36-31-23-13-12-22-30(31)34-32-26-18-8-10-20-28(26)33(29-21-11-9-19-27(29)32)35(34)37(24-14-4-2-5-15-24)25-16-6-3-7-17-25/h8-13,18-25,32-33H,2-7,14-17H2,1H3
InChI key:InChIKey=TWLOVWRCGQNALJ-UHFFFAOYSA-N
SMILES:P(C1=C(C2C=3C(C1C=4C2=CC=CC4)=CC=CC3)C5=C(OC)C=CC=C5)(C6CCCCC6)C7CCCCC7
Synonyms:- Dicyclohexyl[9,10-dihydro-12-(2-methoxyphenyl)-9,10-ethenoanthracen-11-yl]phosphine
- Phosphine, dicyclohexyl[9,10-dihydro-12-(2-methoxyphenyl)-9,10-ethenoanthracen-11-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.