CAS 1166996-41-3
:2-(1,3-Dioxolan-2-yl)-1-(2-fluorophenyl)ethanone
Description:
2-(1,3-Dioxolan-2-yl)-1-(2-fluorophenyl)ethanone is an organic compound characterized by its unique structural features, which include a dioxolane ring and a fluorophenyl group. The presence of the dioxolane moiety suggests that this compound may exhibit properties typical of cyclic ethers, such as moderate polarity and potential reactivity in nucleophilic substitution reactions. The fluorophenyl substituent introduces a fluorine atom, which can influence the compound's electronic properties, potentially enhancing its lipophilicity and altering its reactivity compared to non-fluorinated analogs. This compound may be of interest in medicinal chemistry due to its potential biological activity, as the combination of a dioxolane and a fluorinated aromatic system can lead to unique interactions with biological targets. Additionally, the presence of the carbonyl group (ethanone) indicates that it may participate in various chemical reactions, including condensation and acylation. Overall, 2-(1,3-Dioxolan-2-yl)-1-(2-fluorophenyl)ethanone presents a versatile framework for further exploration in synthetic and medicinal chemistry.
Formula:C11H11FO3
InChI:InChI=1S/C11H11FO3/c12-9-4-2-1-3-8(9)10(13)7-11-14-5-6-15-11/h1-4,11H,5-7H2
InChI key:InChIKey=WRBZJYYIDUTKJY-UHFFFAOYSA-N
SMILES:C(CC1OCCO1)(=O)C2=C(F)C=CC=C2
Synonyms:- 2-(1,3-Dioxolan-2-yl)-1-(2-fluorophenyl)ethan-1-one
- Ethanone, 2-(1,3-dioxolan-2-yl)-1-(2-fluorophenyl)-
- 2-(1,3-Dioxolan-2-yl)-1-(2-fluorophenyl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.