CAS 1167055-31-3

4,6-Dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid

Description:

4,6-Dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrazolo and pyridine ring structures. This compound features two methyl groups at the 4 and 6 positions of the pyrazolo ring, contributing to its unique chemical properties. The presence of a carboxylic acid functional group at the 3-position enhances its acidity and reactivity, making it a potential candidate for various chemical reactions and applications in medicinal chemistry. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its structure suggests potential biological activity, which has led to interest in its use as a pharmacological agent. Additionally, the compound's molecular framework allows for various modifications, which can be explored for developing derivatives with enhanced properties. As with many heterocycles, it may also participate in coordination chemistry, potentially interacting with metal ions. Overall, 4,6-Dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid is a versatile compound with significant implications in research and development.

Formula: C₁₀H₁₀N₂O₂

InChI: InChI=1S/C10H10N2O2/c1-6-3-7(2)9-8(10(13)14)4-11-12(9)5-6/h3-5H,1-2H3,(H,13,14)

InChI key: InChIKey=NMLXTSNTRKVGSX-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2N(C=C(C)C=C2C)N=C1

Synonyms:

• Pyrazolo[1,5-a]pyridine-3-carboxylic acid, 4,6-dimethyl-
• 4,6-Dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid

4,6-dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid

CAS: 1167055-31-3

Formula: C₁₀H₁₀N₂O₂

Molecular weight: 190.1986

Ref: IN-DA000D05