CymitQuimica logo

CAS 1167055-34-6

:

7-Fluoro-5-nitro-1H-indole-2-carboxylic acid

Description:
7-Fluoro-5-nitro-1H-indole-2-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluoro group at the 7-position and a nitro group at the 5-position contributes to its unique reactivity and potential biological activity. The carboxylic acid functional group at the 2-position enhances its solubility in polar solvents and may influence its interaction with biological targets. This compound is of interest in medicinal chemistry and research due to its potential applications in drug development, particularly in the field of anti-cancer or anti-inflammatory agents. Its molecular properties, such as polarity and acidity, are influenced by the substituents on the indole ring, which can affect its pharmacokinetics and pharmacodynamics. Overall, 7-Fluoro-5-nitro-1H-indole-2-carboxylic acid represents a versatile scaffold for further chemical modifications and investigations in various chemical and biological contexts.
Formula:C9H5FN2O4
InChI:InChI=1S/C9H5FN2O4/c10-6-3-5(12(15)16)1-4-2-7(9(13)14)11-8(4)6/h1-3,11H,(H,13,14)
InChI key:InChIKey=DAEPDAFWYPLRHC-UHFFFAOYSA-N
SMILES:FC1=C2C(C=C(C(O)=O)N2)=CC(N(=O)=O)=C1
Synonyms:
  • 1H-Indole-2-carboxylic acid, 7-fluoro-5-nitro-
  • 7-Fluoro-5-nitro-1H-indole-2-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.