CAS 1167055-38-0
:2-Fluoro-N1,N1-dimethyl-5-nitro-1,4-benzenediamine
Description:
2-Fluoro-N1,N1-dimethyl-5-nitro-1,4-benzenediamine is an organic compound characterized by its aromatic structure, which includes a fluorine atom and a nitro group attached to a benzene ring. The presence of two dimethylamino groups contributes to its basicity and potential reactivity. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and crystalline form. It is soluble in organic solvents, which is common for many aromatic amines, but may have limited solubility in water due to its hydrophobic aromatic structure. The nitro group introduces significant electron-withdrawing characteristics, influencing the compound's reactivity and stability. This substance may be of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in synthesis and as a building block for more complex molecules. Safety precautions should be taken when handling this compound, as nitro-substituted aromatic amines can pose health risks, including potential carcinogenicity.
Formula:C8H10FN3O2
InChI:InChI=1S/C8H10FN3O2/c1-11(2)7-4-8(12(13)14)6(10)3-5(7)9/h3-4H,10H2,1-2H3
InChI key:InChIKey=QZKLQJUQYFPADH-UHFFFAOYSA-N
SMILES:N(C)(C)C1=CC(N(=O)=O)=C(N)C=C1F
Synonyms:- 2-Fluoro-N1,N1-dimethyl-5-nitro-1,4-benzenediamine
- 1,4-Benzenediamine, 2-fluoro-N1,N1-dimethyl-5-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
