
CAS 1167055-45-9
:7-Methyl-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid
Description:
7-Methyl-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrrole and pyridine rings fused together, which contributes to its unique chemical properties. This compound features a carboxylic acid functional group, which enhances its solubility in polar solvents and allows for potential interactions in biological systems. The presence of the methyl group at the 7-position of the pyrrole ring influences its electronic properties and steric hindrance, potentially affecting its reactivity and biological activity. As a member of the pyrrolopyridine family, it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The compound's structure suggests it could participate in various chemical reactions, including acylation and esterification, due to the carboxylic acid group. Additionally, its unique arrangement of nitrogen atoms within the rings may contribute to its ability to form coordination complexes with metal ions. Overall, 7-Methyl-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid is a compound of significant interest for further research in both synthetic and medicinal chemistry.
Formula:C9H8N2O2
InChI:InChI=1S/C9H8N2O2/c1-5-8-6(2-3-10-5)7(4-11-8)9(12)13/h2-4,11H,1H3,(H,12,13)
InChI key:InChIKey=XWQRCUXXPFOGNE-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(NC1)=C(C)N=CC2
Synonyms:- 1H-Pyrrolo[2,3-c]pyridine-3-carboxylic acid, 7-methyl-
- 7-Methyl-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
