CAS 1167055-48-2

5,7-Dimethoxy-1H-indazole-3-carboxaldehyde

Description:

5,7-Dimethoxy-1H-indazole-3-carboxaldehyde is a chemical compound characterized by its indazole core, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of two methoxy groups at the 5 and 7 positions enhances its solubility and reactivity, while the aldehyde functional group at the 3 position contributes to its potential as a reactive intermediate in organic synthesis. This compound is typically used in research settings, particularly in medicinal chemistry, due to its potential biological activity. Its structure allows for various modifications, making it a versatile building block in the synthesis of more complex molecules. The compound may exhibit properties such as fluorescence or specific interactions with biological targets, which can be explored in pharmacological studies. As with many organic compounds, handling should be done with care, considering safety protocols to avoid exposure or adverse reactions. Overall, 5,7-Dimethoxy-1H-indazole-3-carboxaldehyde represents a significant compound in the realm of synthetic organic chemistry and drug development.

Formula: C₁₀H₁₀N₂O₃

InChI: InChI=1S/C10H10N2O3/c1-14-6-3-7-8(5-13)11-12-10(7)9(4-6)15-2/h3-5H,1-2H3,(H,11,12)

InChI key: InChIKey=XWBJOQBSRCFJSX-UHFFFAOYSA-N

SMILES: C(=O)C=1C=2C(=C(OC)C=C(OC)C2)NN1

Synonyms:

• 1H-Indazole-3-carboxaldehyde, 5,7-dimethoxy-
• 5,7-Dimethoxy-1H-indazole-3-carboxaldehyde