CymitQuimica logo

CAS 1167055-58-4

:

2-Fluoro-1-methyl-3,4-dinitrobenzene

Description:
2-Fluoro-1-methyl-3,4-dinitrobenzene is an organic compound characterized by the presence of a fluorine atom, a methyl group, and two nitro groups attached to a benzene ring. The molecular structure features a fluorine substituent at the second position and a methyl group at the first position, with nitro groups located at the third and fourth positions of the aromatic ring. This compound is typically a yellow to orange solid at room temperature and is known for its potential applications in the field of organic synthesis and as an intermediate in the production of various chemical products. It exhibits properties such as moderate solubility in organic solvents and may have varying degrees of reactivity due to the presence of the electron-withdrawing nitro groups. Additionally, the compound's fluorine atom can influence its electronic properties and reactivity. Safety precautions should be taken when handling this substance, as it may pose health risks and environmental hazards.
Formula:C7H5FN2O4
InChI:InChI=1S/C7H5FN2O4/c1-4-2-3-5(9(11)12)7(6(4)8)10(13)14/h2-3H,1H3
InChI key:InChIKey=UWOBPHMHCZNDMT-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(N(=O)=O)C=CC(C)=C1F
Synonyms:
  • 2-Fluoro-1-methyl-3,4-dinitrobenzene
  • Benzene, 2-fluoro-1-methyl-3,4-dinitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.