CAS 1167055-63-1

4-Chloro-5,7-dimethyl-1H-indole

Description:

4-Chloro-5,7-dimethyl-1H-indole is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a chlorine atom at the 4-position and two methyl groups at the 5 and 7 positions contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent used. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and research. The chlorine substituent can influence the compound's reactivity and interaction with biological targets, while the methyl groups may affect its steric properties and lipophilicity. As with many indole derivatives, 4-Chloro-5,7-dimethyl-1H-indole may participate in various chemical reactions, including electrophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₀H₁₀ClN

InChI: InChI=1S/C10H10ClN/c1-6-5-7(2)10-8(9(6)11)3-4-12-10/h3-5,12H,1-2H3

InChI key: InChIKey=PIUDPAIHUPUSGB-UHFFFAOYSA-N

SMILES: ClC1=C2C(=C(C)C=C1C)NC=C2

Synonyms:

• 4-Chloro-5,7-dimethyl-1H-indole
• 1H-Indole, 4-chloro-5,7-dimethyl-