CymitQuimica logo

CAS 1167055-66-4

:

3,4-Dimethyl 1H-indazole-3,4-dicarboxylate

Description:
3,4-Dimethyl 1H-indazole-3,4-dicarboxylate is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features two carboxylate groups (-COO-) at the 3 and 4 positions of the indazole ring, contributing to its potential reactivity and solubility in various solvents. The presence of two methyl groups at the 3 and 4 positions enhances its lipophilicity and may influence its biological activity. As a dicarboxylate ester, it can participate in various chemical reactions, including hydrolysis and esterification. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the indazole moiety's known biological activities. Additionally, its unique structural features may allow for interactions with biological targets, making it a candidate for further research in drug discovery. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C11H10N2O4
InChI:InChI=1S/C11H10N2O4/c1-16-10(14)6-4-3-5-7-8(6)9(13-12-7)11(15)17-2/h3-5H,1-2H3,(H,12,13)
InChI key:InChIKey=GWQLJRXJHTZIFA-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=2C(NN1)=CC=CC2C(OC)=O
Synonyms:
  • 3,4-Dimethyl 1H-indazole-3,4-dicarboxylate
  • 1H-Indazole-3,4-dicarboxylic acid, 3,4-dimethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.