CymitQuimica logo

CAS 1167055-68-6

:

4-(Bromomethyl)-2-methylpyridine

Description:
4-(Bromomethyl)-2-methylpyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromomethyl group at the 4-position and a methyl group at the 2-position contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to the hydrophobic nature of the aromatic ring. The bromomethyl group makes it a versatile intermediate in organic synthesis, allowing for various substitution reactions. Additionally, the nitrogen atom in the pyridine ring can participate in coordination with metal ions, making this compound of interest in coordination chemistry. Safety precautions should be taken when handling this substance, as brominated compounds can be hazardous. Overall, 4-(Bromomethyl)-2-methylpyridine is a valuable compound in synthetic organic chemistry and materials science.
Formula:C7H8BrN
InChI:InChI=1S/C7H8BrN/c1-6-4-7(5-8)2-3-9-6/h2-4H,5H2,1H3
InChI key:InChIKey=MVVGGQWHXOPXRQ-UHFFFAOYSA-N
SMILES:C(Br)C=1C=C(C)N=CC1
Synonyms:
  • 2-Methyl-4-(bromomethyl)pyridine
  • Pyridine, 4-(bromomethyl)-2-methyl-
  • 4-(Bromomethyl)-2-methylpyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.