CymitQuimica logo

CAS 1167055-69-7

:

Methyl 3-bromo-1H-pyrrolo[3,2-c]pyridine-4-carboxylate

Description:
Methyl 3-bromo-1H-pyrrolo[3,2-c]pyridine-4-carboxylate is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which combines elements of both pyrrole and pyridine. This compound features a bromine atom at the 3-position and a methoxycarbonyl group at the 4-position, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the bromine substituent enhances its electrophilic character, making it a useful intermediate in various chemical reactions, including cross-coupling reactions and nucleophilic substitutions. The methyl ester functional group provides a site for further functionalization, allowing for the synthesis of more complex derivatives. This compound is of interest in the development of pharmaceuticals due to its potential biological activity, particularly in targeting specific enzymes or receptors. Its solubility and stability in organic solvents make it suitable for various synthetic applications. As with many brominated compounds, care should be taken regarding its handling and disposal due to potential environmental and health impacts.
Formula:C9H7BrN2O2
InChI:InChI=1S/C9H7BrN2O2/c1-14-9(13)8-7-5(10)4-12-6(7)2-3-11-8/h2-4,12H,1H3
InChI key:InChIKey=ASIOHJVXERFKNL-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(NC=C2Br)=CC=N1
Synonyms:
  • 1H-Pyrrolo[3,2-c]pyridine-4-carboxylic acid, 3-bromo-, methyl ester
  • Methyl 3-bromo-1H-pyrrolo[3,2-c]pyridine-4-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.