CAS 1167055-70-0

6-Iodo-2-methyl-3-nitropyridine

Description:

6-Iodo-2-methyl-3-nitropyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of an iodine atom at the 6-position and a nitro group at the 3-position, along with a methyl group at the 2-position, contributes to its unique chemical properties. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents. Its molecular structure suggests potential reactivity due to the electron-withdrawing nature of the nitro group and the halogen substituent, which can influence its behavior in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. Additionally, the presence of the iodine atom may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed. Overall, 6-Iodo-2-methyl-3-nitropyridine is a compound of interest in both synthetic and medicinal chemistry contexts.

Formula: C₆H₅IN₂O₂

InChI: InChI=1S/C6H5IN2O2/c1-4-5(9(10)11)2-3-6(7)8-4/h2-3H,1H3

InChI key: InChIKey=FQDUZOJNGQBNBV-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C)N=C(I)C=C1

Synonyms:

• Pyridine, 6-iodo-2-methyl-3-nitro-
• 6-Iodo-2-methyl-3-nitropyridine