CAS 1167055-72-2

5-Iodo-3-pyridinemethanamine

Description:

5-Iodo-3-pyridinemethanamine is an organic compound characterized by the presence of a pyridine ring, an amino group, and an iodine substituent. The molecular structure features a pyridine moiety with an amino group attached to the methylene carbon adjacent to the nitrogen of the ring, and an iodine atom at the 5-position of the pyridine. This compound is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents, which is common for amines and halogenated compounds. Its iodine substituent can impart unique reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. The presence of the amino group suggests potential applications in medicinal chemistry, particularly in the synthesis of pharmaceuticals or agrochemicals. Additionally, the compound may exhibit biological activity, which can be explored in drug development. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact.

Formula: C₆H₇IN₂

InChI: InChI=1S/C6H7IN2/c7-6-1-5(2-8)3-9-4-6/h1,3-4H,2,8H2

InChI key: InChIKey=YFTVRNCNEYIBND-UHFFFAOYSA-N

SMILES: C(N)C=1C=C(I)C=NC1

Synonyms:

• 5-Iodo-3-pyridinemethanamine
• 3-Pyridinemethanamine, 5-iodo-