CAS 1167055-73-3

2-Bromo-4-oxazolecarboxylic acid

Description:

2-Bromo-4-oxazolecarboxylic acid is a heterocyclic organic compound characterized by the presence of a bromine atom and an oxazole ring, which contributes to its unique chemical properties. The oxazole ring is a five-membered aromatic ring containing both nitrogen and oxygen, enhancing the compound's reactivity and potential for forming hydrogen bonds. This compound typically exhibits moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, which can participate in hydrogen bonding. The bromine substituent can influence the compound's reactivity, making it a useful intermediate in various organic synthesis reactions, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the presence of the carboxylic acid group allows for potential derivatization, enabling further functionalization. Overall, 2-Bromo-4-oxazolecarboxylic acid is of interest in synthetic organic chemistry due to its structural features and reactivity, which can be leveraged in the design of more complex molecules.

Formula: C₄H₂BrNO₃

InChI: InChI=1S/C4H2BrNO3/c5-4-6-2(1-9-4)3(7)8/h1H,(H,7,8)

InChI key: InChIKey=OLHDAGXOANXUHG-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N=C(Br)OC1

Synonyms:

• 2-Bromo-4-oxazolecarboxylic acid
• 4-Oxazolecarboxylic acid, 2-bromo-
• 2-Bromo-1,3-oxazole-4-carboxylic acid
• 2-Bromooxazole-4-carboxylic acid

4-Oxazolecarboxylic acid, 2-bromo-

CAS: 1167055-73-3

Formula: C₄H₂BrNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 191.9676

Ref: IN-DA000D1Y

2-Bromooxazole-4-carboxylic acid

CAS: 1167055-73-3

2-Bromooxazole-4-carboxylic acid

Purity: 97%

Molecular weight: 191.97g/mol

Ref: 54-OR72242

2-Bromooxazole-4-carboxylic acid

CAS: 1167055-73-3

Formula: C₄H₂BrNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 191.968

Ref: 10-F220234