CAS 1167055-88-0
:4,5-Difluoro-1H-indole-7-carbonitrile
Description:
4,5-Difluoro-1H-indole-7-carbonitrile is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of two fluorine atoms at the 4 and 5 positions of the indole ring significantly influences its electronic properties and reactivity. The carbonitrile functional group at the 7 position introduces a polar and reactive site, making the compound potentially useful in various chemical reactions and applications, including medicinal chemistry and material science. This compound is typically a solid at room temperature and may exhibit specific solubility characteristics depending on the solvent used. Its unique structure allows for potential interactions with biological targets, making it of interest in drug discovery and development. Additionally, the fluorine substituents can enhance metabolic stability and lipophilicity, which are important factors in pharmacokinetics. As with many fluorinated compounds, it may also exhibit distinct physical and chemical properties compared to its non-fluorinated analogs.
Formula:C9H4F2N2
InChI:InChI=1S/C9H4F2N2/c10-7-3-5(4-12)9-6(8(7)11)1-2-13-9/h1-3,13H
InChI key:InChIKey=FVKXSDGBBRTHLC-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(=C(F)C(F)=C1)C=CN2
Synonyms:- 1H-Indole-7-carbonitrile, 4,5-difluoro-
- 4,5-Difluoro-1H-indole-7-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
