CAS 1167055-97-1

5-Methyl-6-(phenylmethoxy)-1H-indole-3-carboxaldehyde

Description:

5-Methyl-6-(phenylmethoxy)-1H-indole-3-carboxaldehyde is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a methyl group at the 5-position and a phenylmethoxy group at the 6-position, contributing to its unique chemical properties and potential reactivity. The presence of the aldehyde functional group at the 3-position indicates that it can participate in various chemical reactions, such as nucleophilic addition or condensation reactions. The compound's molecular structure suggests it may exhibit interesting biological activities, making it a candidate for research in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, 5-Methyl-6-(phenylmethoxy)-1H-indole-3-carboxaldehyde represents a complex organic molecule with potential utility in various chemical and pharmaceutical contexts.

Formula: C₁₇H₁₅NO₂

InChI: InChI=1S/C17H15NO2/c1-12-7-15-14(10-19)9-18-16(15)8-17(12)20-11-13-5-3-2-4-6-13/h2-10,18H,11H2,1H3

InChI key: InChIKey=NQFXLVRAYRCNDM-UHFFFAOYSA-N

SMILES: C(=O)C=1C=2C(=CC(OCC3=CC=CC=C3)=C(C)C2)NC1

Synonyms:

• 5-Methyl-6-(phenylmethoxy)-1H-indole-3-carboxaldehyde
• 1H-Indole-3-carboxaldehyde, 5-methyl-6-(phenylmethoxy)-

1H-Indole-3-carboxaldehyde, 5-methyl-6-(phenylmethoxy)-

CAS: 1167055-97-1

Formula: C₁₇H₁₅NO₂

Molecular weight: 265.3065

Ref: IN-DA000D2S