CymitQuimica logo

CAS 1167056-07-6

:

3,4,7-Trichloro-5-methoxy-1H-indazole

Description:
3,4,7-Trichloro-5-methoxy-1H-indazole is a synthetic chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of three chlorine atoms at the 3, 4, and 7 positions contributes to its reactivity and potential biological activity, while the methoxy group at the 5 position enhances its solubility and stability. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its unique structural features that may interact with biological targets. Its molecular structure suggests that it may exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological effects would depend on further empirical studies. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors, making it important to consider these characteristics in practical applications. As with many halogenated compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.
Formula:C8H5Cl3N2O
InChI:InChI=1S/C8H5Cl3N2O/c1-14-4-2-3(9)7-5(6(4)10)8(11)13-12-7/h2H,1H3,(H,12,13)
InChI key:InChIKey=RWCWIFBBMLAPBF-UHFFFAOYSA-N
SMILES:ClC1=C2C(=C(Cl)C=C1OC)NN=C2Cl
Synonyms:
  • 3,4,7-Trichloro-5-methoxy-1H-indazole
  • 1H-Indazole, 3,4,7-trichloro-5-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.