CAS 1167056-08-7

4-Methoxy-7-methyl-6-nitro-1H-indole

Description:

4-Methoxy-7-methyl-6-nitro-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features a methoxy group (-OCH3) at the 4-position, a methyl group (-CH3) at the 7-position, and a nitro group (-NO2) at the 6-position of the indole ring. These substituents contribute to its chemical reactivity and potential biological activity. The presence of the nitro group often enhances the compound's electrophilic properties, making it a candidate for various chemical reactions. Additionally, the methoxy group can influence the compound's solubility and polarity, while the methyl group may affect steric hindrance and overall stability. 4-Methoxy-7-methyl-6-nitro-1H-indole may be of interest in medicinal chemistry and research due to its potential pharmacological properties, although specific applications would depend on further studies and evaluations. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₀H₁₀N₂O₃

InChI: InChI=1S/C10H10N2O3/c1-6-8(12(13)14)5-9(15-2)7-3-4-11-10(6)7/h3-5,11H,1-2H3

InChI key: InChIKey=CCQIOTMJACGJLX-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(=C(C)C(N(=O)=O)=C1)NC=C2

Synonyms:

• 4-Methoxy-7-methyl-6-nitro-1H-indole
• 1H-Indole, 4-methoxy-7-methyl-6-nitro-

1H-Indole, 4-methoxy-7-methyl-6-nitro-

CAS: 1167056-08-7

Formula: C₁₀H₁₀N₂O₃

Molecular weight: 206.198

Ref: IN-DA000D2J