CAS 1167056-11-2

3-Chloro-5-nitro-1H-pyrrolo[2,3-c]pyridine

Description:

3-Chloro-5-nitro-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its fused pyridine and pyrrole rings, which contribute to its unique chemical properties. The presence of a chlorine atom and a nitro group at specific positions on the pyrrolo-pyridine structure enhances its reactivity and potential biological activity. This compound typically exhibits moderate to high solubility in polar organic solvents, while its solid-state properties may include crystalline or amorphous forms depending on the synthesis method. The nitro group is known for its electron-withdrawing characteristics, which can influence the compound's reactivity in electrophilic substitution reactions. Additionally, the chlorine substituent can affect the compound's lipophilicity and overall pharmacokinetic properties. Due to its structural features, 3-Chloro-5-nitro-1H-pyrrolo[2,3-c]pyridine may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Safety and handling precautions should be observed, as with many halogenated and nitro compounds, due to potential toxicity and environmental concerns.

Formula: C₇H₄ClN₃O₂

InChI: InChI=1S/C7H4ClN3O2/c8-5-2-9-6-3-10-7(11(12)13)1-4(5)6/h1-3,9H

InChI key: InChIKey=TXNLKZBXMPRLAS-UHFFFAOYSA-N

SMILES: ClC=1C=2C(=CN=C(N(=O)=O)C2)NC1

Synonyms:

• 1H-Pyrrolo[2,3-c]pyridine, 3-chloro-5-nitro-
• 3-Chloro-5-nitro-1H-pyrrolo[2,3-c]pyridine

1H-Pyrrolo[2,3-c]pyridine, 3-chloro-5-nitro-

CAS: 1167056-11-2

Formula: C₇H₄ClN₃O₂

Molecular weight: 197.5786

Ref: IN-DA000D2G