CAS 1167056-13-4
:4-Chloro-1-hydroxy-6-nitro-1H-indole
Description:
4-Chloro-1-hydroxy-6-nitro-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a chlorine atom at the 4-position, a hydroxyl group at the 1-position, and a nitro group at the 6-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. It is likely to be soluble in polar organic solvents due to the hydroxyl group, while its aromatic nature may confer some degree of stability against degradation. The nitro group can participate in electrophilic substitution reactions, making the compound reactive under certain conditions. Additionally, the presence of the chlorine atom can influence the compound's reactivity and biological activity. Overall, 4-Chloro-1-hydroxy-6-nitro-1H-indole is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications and reactivity.
Formula:C8H5ClN2O3
InChI:InChI=1S/C8H5ClN2O3/c9-7-3-5(11(13)14)4-8-6(7)1-2-10(8)12/h1-4,12H
InChI key:InChIKey=HISWFFCUTSXRFX-UHFFFAOYSA-N
SMILES:ON1C=2C(=C(Cl)C=C(N(=O)=O)C2)C=C1
Synonyms:- 1H-Indole, 4-chloro-1-hydroxy-6-nitro-
- 4-Chloro-1-hydroxy-6-nitro-1H-indole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
