CAS 1167056-18-9
:5-Methyl-1H-indol-6-ol
Description:
5-Methyl-1H-indol-6-ol, identified by its CAS number 1167056-18-9, is an organic compound belonging to the indole family, characterized by a fused bicyclic structure containing a benzene ring and a pyrrole ring. This compound features a hydroxyl group (-OH) at the 6-position and a methyl group (-CH3) at the 5-position of the indole structure, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the hydroxyl group. The compound may participate in various chemical reactions, including hydrogen bonding and electrophilic substitutions, owing to its functional groups. Additionally, 5-Methyl-1H-indol-6-ol may possess biological activity, making it of interest in pharmaceutical research and development. Its stability, reactivity, and potential applications in medicinal chemistry are subjects of ongoing investigation, highlighting the importance of indole derivatives in various chemical and biological contexts.
Formula:C9H9NO
InChI:InChI=1S/C9H9NO/c1-6-4-7-2-3-10-8(7)5-9(6)11/h2-5,10-11H,1H3
InChI key:InChIKey=FQFKFEHJKYITSU-UHFFFAOYSA-N
SMILES:CC=1C=C2C(=CC1O)NC=C2
Synonyms:- 1H-Indol-6-ol, 5-methyl-
- 5-Methyl-1H-indol-6-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
