CAS 1167056-19-0
:5-Chloro-3-nitro-1H-pyrrolo[2,3-c]pyridine
Description:
5-Chloro-3-nitro-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its fused pyridine and pyrrole rings, which contribute to its unique chemical properties. The presence of a chlorine atom and a nitro group at specific positions on the pyrrolo-pyridine structure enhances its reactivity and potential applications in medicinal chemistry. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water, reflecting its hydrophobic characteristics. Its molecular structure suggests potential for interactions with biological targets, making it of interest in drug discovery and development. Additionally, the presence of the nitro group can influence its electronic properties, potentially affecting its behavior in chemical reactions. Safety data should be consulted for handling, as halogenated and nitro compounds can pose health risks. Overall, 5-Chloro-3-nitro-1H-pyrrolo[2,3-c]pyridine represents a valuable compound for research in organic synthesis and pharmacology.
Formula:C7H4ClN3O2
InChI:InChI=1S/C7H4ClN3O2/c8-7-1-4-5(2-10-7)9-3-6(4)11(12)13/h1-3,9H
InChI key:InChIKey=XJNBRTKNXJRBBE-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(NC1)=CN=C(Cl)C2
Synonyms:- 1H-Pyrrolo[2,3-c]pyridine, 5-chloro-3-nitro-
- 5-Chloro-3-nitro-1H-pyrrolo[2,3-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
