CAS 1167056-20-3
:5-Methyl-1H-indazole-6-carbonitrile
Description:
5-Methyl-1H-indazole-6-carbonitrile is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a methyl group at the 5-position and a cyano group at the 6-position contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is often utilized in medicinal chemistry and drug discovery due to its potential biological activity. The cyano group can participate in various chemical reactions, making it a versatile intermediate in synthetic organic chemistry. Additionally, the indazole moiety is known for its presence in various pharmacologically active compounds, which may suggest potential applications in pharmaceuticals. As with many organic compounds, safety data should be consulted to understand its handling and toxicity. Overall, 5-Methyl-1H-indazole-6-carbonitrile represents a significant structure in the realm of organic synthesis and medicinal chemistry.
Formula:C9H7N3
InChI:InChI=1S/C9H7N3/c1-6-2-8-5-11-12-9(8)3-7(6)4-10/h2-3,5H,1H3,(H,11,12)
InChI key:InChIKey=JSNIACMGFQQQIX-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C2C(=CC1C)C=NN2
Synonyms:- 5-Methyl-1H-indazole-6-carbonitrile
- 1H-Indazole-6-carbonitrile, 5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
