CAS 1167056-22-5

6-(1,1-Dimethylethyl)-1H-indazole

Description:

6-(1,1-Dimethylethyl)-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a tert-butyl group (1,1-dimethylethyl) at the 6-position of the indazole enhances its hydrophobic properties, influencing its solubility and reactivity. This compound is typically used in research and development, particularly in medicinal chemistry, due to its potential biological activities. It may exhibit properties such as anti-inflammatory or anti-cancer effects, although specific biological activities can vary based on structural modifications and the presence of other functional groups. The compound's molecular structure contributes to its stability and reactivity, making it a subject of interest in various chemical syntheses and applications. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.

Formula: C₁₁H₁₄N₂

InChI: InChI=1S/C11H14N2/c1-11(2,3)9-5-4-8-7-12-13-10(8)6-9/h4-7H,1-3H3,(H,12,13)

InChI key: InChIKey=USDLOQNSGBTYCH-UHFFFAOYSA-N

SMILES: C(C)(C)(C)C=1C=C2C(=CC1)C=NN2

Synonyms:

• 6-(1,1-Dimethylethyl)-1H-indazole
• 1H-Indazole, 6-(1,1-dimethylethyl)-
• 6-tert-Butyl-1H-indazole

1H-Indazole, 6-(1,1-dimethylethyl)-

CAS: 1167056-22-5

Formula: C₁₁H₁₄N₂

Molecular weight: 174.2423

Ref: IN-DA000D3K