CAS 1167056-24-7
:6-(1,1-Dimethylethyl)-3-iodo-1H-indazole
Description:
6-(1,1-Dimethylethyl)-3-iodo-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a 1,1-dimethylethyl group, also known as a tert-butyl group, at the 6-position contributes to its hydrophobic characteristics and steric bulk, potentially influencing its reactivity and interactions with biological targets. The iodine atom at the 3-position introduces a halogen, which can enhance the compound's electrophilicity and may play a role in various chemical reactions, including nucleophilic substitutions. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas where indazole derivatives have shown efficacy. As with many organic compounds, its solubility, stability, and reactivity will depend on the specific conditions and solvents used in experiments or applications.
Formula:C11H13IN2
InChI:InChI=1S/C11H13IN2/c1-11(2,3)7-4-5-8-9(6-7)13-14-10(8)12/h4-6H,1-3H3,(H,13,14)
InChI key:InChIKey=JUXHCNDTBZFDCR-UHFFFAOYSA-N
SMILES:IC=1C=2C(=CC(C(C)(C)C)=CC2)NN1
Synonyms:- 6-(1,1-Dimethylethyl)-3-iodo-1H-indazole
- 1H-Indazole, 6-(1,1-dimethylethyl)-3-iodo-
- 6-tert-Butyl-3-iodo-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
