CAS 1167056-25-8

3,4-Dichloro-5-methoxy-1H-indazole

Description:

3,4-Dichloro-5-methoxy-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of two chlorine atoms at the 3 and 4 positions, along with a methoxy group at the 5 position, contributes to its unique chemical properties. This compound is typically classified as a halogenated indazole derivative, which may exhibit various biological activities due to the electron-withdrawing nature of the chlorine atoms and the electron-donating properties of the methoxy group. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the indazole ring, making it a subject of interest for further research in organic synthesis and drug design. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₈H₆Cl₂N₂O

InChI: InChI=1S/C8H6Cl2N2O/c1-13-5-3-2-4-6(7(5)9)8(10)12-11-4/h2-3H,1H3,(H,11,12)

InChI key: InChIKey=HTQHAYMVFKSVCI-UHFFFAOYSA-N

SMILES: ClC1=C2C(=CC=C1OC)NN=C2Cl

Synonyms:

• 3,4-Dichloro-5-methoxy-1H-indazole
• 1H-Indazole, 3,4-dichloro-5-methoxy-