
CAS 1167056-27-0
:1,3-Dihydro-5,7-dimethoxy-2H-indol-2-one
Description:
1,3-Dihydro-5,7-dimethoxy-2H-indol-2-one is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features two methoxy groups (-OCH3) at the 5 and 7 positions, contributing to its unique chemical properties and potential biological activity. The presence of the 1,3-dihydro configuration indicates that it has a saturated bond in the indole system, which can influence its reactivity and stability. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its CAS number, 1167056-27-0, allows for precise identification and retrieval of information regarding its synthesis, applications, and safety data. Overall, the structural characteristics of 1,3-Dihydro-5,7-dimethoxy-2H-indol-2-one suggest potential utility in various chemical and biological contexts, warranting further investigation into its properties and applications.
Formula:C10H11NO3
InChI:InChI=1S/C10H11NO3/c1-13-7-3-6-4-9(12)11-10(6)8(5-7)14-2/h3,5H,4H2,1-2H3,(H,11,12)
InChI key:InChIKey=VHCKDECOJTWKGA-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC(OC)=C1)CC(=O)N2
Synonyms:- 1,3-Dihydro-5,7-dimethoxy-2H-indol-2-one
- 2H-Indol-2-one, 1,3-dihydro-5,7-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
