CAS 1167056-28-1
:7-Methoxy-5-(phenylmethoxy)-1H-indole
Description:
7-Methoxy-5-(phenylmethoxy)-1H-indole is an organic compound characterized by its indole core, which is a bicyclic structure consisting of a benzene ring fused to a pyrrole ring. The presence of methoxy groups at the 7 and 5 positions enhances its solubility and reactivity, making it a versatile compound in organic synthesis and medicinal chemistry. The phenylmethoxy substituent at the 5 position contributes to its potential biological activity, possibly influencing interactions with various biological targets. This compound may exhibit properties such as fluorescence or photostability, depending on its molecular structure and substituents. Its unique arrangement of functional groups can lead to interesting pharmacological profiles, making it a candidate for further research in drug development. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and potential therapeutic applications.
Formula:C16H15NO2
InChI:InChI=1S/C16H15NO2/c1-18-15-10-14(9-13-7-8-17-16(13)15)19-11-12-5-3-2-4-6-12/h2-10,17H,11H2,1H3
InChI key:InChIKey=RZUJJJAOTXOLJH-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC(OCC3=CC=CC=C3)=C1)C=CN2
Synonyms:- 1H-Indole, 7-methoxy-5-(phenylmethoxy)-
- 7-Methoxy-5-(phenylmethoxy)-1H-indole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
