CAS 1167056-31-6
:3,4-Dibromo-5-methoxy-1H-indazole
Description:
3,4-Dibromo-5-methoxy-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of two bromine atoms at the 3 and 4 positions of the indazole ring contributes to its reactivity and potential biological activity. The methoxy group at the 5 position enhances its solubility and may influence its interaction with biological targets. This compound is typically used in research settings, particularly in medicinal chemistry, due to its potential pharmacological properties. Its molecular structure suggests that it may exhibit unique electronic properties and steric effects, which can be important in drug design. Additionally, the bromine substituents can facilitate various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a versatile intermediate in synthetic organic chemistry. Safety and handling precautions should be observed due to the presence of halogens, which can pose environmental and health risks.
Formula:C8H6Br2N2O
InChI:InChI=1S/C8H6Br2N2O/c1-13-5-3-2-4-6(7(5)9)8(10)12-11-4/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=YNVCADVECWFANC-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CC=C1OC)NN=C2Br
Synonyms:- 3,4-Dibromo-5-methoxy-1H-indazole
- 1H-Indazole, 3,4-dibromo-5-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.