CAS 1167056-33-8
:4-Methoxy-7-methyl-1H-indole-6-carbonitrile
Description:
4-Methoxy-7-methyl-1H-indole-6-carbonitrile is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a methoxy group (-OCH3) at the 4-position and a methyl group (-CH3) at the 7-position contributes to its unique chemical properties and reactivity. The carbonitrile functional group (-C≡N) at the 6-position enhances its potential for nucleophilic reactions and increases its polarity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. Additionally, the presence of multiple functional groups allows for diverse synthetic pathways and modifications, which can lead to the development of derivatives with tailored properties. As with many indole derivatives, it may also display interesting photophysical properties, making it suitable for applications in materials science.
Formula:C11H10N2O
InChI:InChI=1S/C11H10N2O/c1-7-8(6-12)5-10(14-2)9-3-4-13-11(7)9/h3-5,13H,1-2H3
InChI key:InChIKey=GHAXLEIIZJXIAP-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=C(C)C(C#N)=C1)NC=C2
Synonyms:- 1H-Indole-6-carbonitrile, 4-methoxy-7-methyl-
- 4-Methoxy-7-methyl-1H-indole-6-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
