CAS 1167056-34-9

7-Methoxy-5-(phenylmethoxy)-1H-indazole-3-carboxylic acid

Description:

7-Methoxy-5-(phenylmethoxy)-1H-indazole-3-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a methoxy group at the 7-position and a phenylmethoxy substituent at the 5-position contributes to its unique chemical properties and potential biological activity. This compound features a carboxylic acid functional group at the 3-position, which can influence its solubility and reactivity. The methoxy and phenylmethoxy groups may enhance lipophilicity, potentially affecting its pharmacokinetics and interactions with biological targets. The compound's structure suggests it may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its CAS number, 1167056-34-9, allows for precise identification in chemical databases and literature. Overall, the combination of functional groups and the indazole framework positions this compound as a subject of interest in drug discovery and development.

Formula: C₁₆H₁₄N₂O₄

InChI: InChI=1S/C16H14N2O4/c1-21-13-8-11(22-9-10-5-3-2-4-6-10)7-12-14(13)17-18-15(12)16(19)20/h2-8H,9H2,1H3,(H,17,18)(H,19,20)

InChI key: InChIKey=XAMIPXOJXLBSGY-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(C(C(O)=O)=NN2)=CC(OCC3=CC=CC=C3)=C1

Synonyms:

• 7-Methoxy-5-(phenylmethoxy)-1H-indazole-3-carboxylic acid
• 1H-Indazole-3-carboxylic acid, 7-methoxy-5-(phenylmethoxy)-

1H-Indazole-3-carboxylic acid, 7-methoxy-5-(phenylmethoxy)-

CAS: 1167056-34-9

Formula: C₁₆H₁₄N₂O₄

Molecular weight: 298.2934

Ref: IN-DA000D38