CymitQuimica logo

CAS 1167056-38-3

:

5-Nitro-1H-indole-7-carboxylic acid

Description:
5-Nitro-1H-indole-7-carboxylic acid is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a nitro group at the 5-position and a carboxylic acid group at the 7-position contributes to its chemical reactivity and potential applications in various fields, including medicinal chemistry and organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid functional group. Its nitro group can participate in electrophilic substitution reactions, while the carboxylic acid can engage in acid-base reactions. The compound may also display biological activity, making it of interest for pharmaceutical research. As with many nitro compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, 5-Nitro-1H-indole-7-carboxylic acid is a versatile compound with significant implications in chemical research and development.
Formula:C9H6N2O4
InChI:InChI=1S/C9H6N2O4/c12-9(13)7-4-6(11(14)15)3-5-1-2-10-8(5)7/h1-4,10H,(H,12,13)
InChI key:InChIKey=WDKDONAAPBDYMD-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(=CC(N(=O)=O)=C1)C=CN2
Synonyms:
  • 5-Nitro-1H-indole-7-carboxylic acid
  • 1H-Indole-7-carboxylic acid, 5-nitro-
  • 5-Nitro-7-indole carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.