CAS 1167056-39-4
:4-Fluoro-7-nitro-1H-indole-2-carboxylic acid
Description:
4-Fluoro-7-nitro-1H-indole-2-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluoro group at the 4-position and a nitro group at the 7-position contributes to its unique reactivity and properties. The carboxylic acid functional group at the 2-position enhances its acidity and solubility in polar solvents. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of electron-withdrawing groups like the nitro and fluoro substituents can influence the compound's electronic properties, potentially affecting its biological activity. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.
Formula:C9H5FN2O4
InChI:InChI=1S/C9H5FN2O4/c10-5-1-2-7(12(15)16)8-4(5)3-6(11-8)9(13)14/h1-3,11H,(H,13,14)
InChI key:InChIKey=KOJMWXQZWHMHAA-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(C=C(C(O)=O)N2)=C(F)C=C1
Synonyms:- 4-Fluoro-7-nitro-1H-indole-2-carboxylic acid
- 1H-Indole-2-carboxylic acid, 4-fluoro-7-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
