
CAS 1167056-40-7
:5-Iodo-7-nitro-1H-indazole
Description:
5-Iodo-7-nitro-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of an iodine atom at the 5-position and a nitro group at the 7-position contributes to its unique reactivity and potential applications in various fields, including medicinal chemistry and materials science. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests that it could participate in electrophilic substitution reactions due to the electron-withdrawing nature of the nitro group, while the iodine atom may facilitate nucleophilic reactions. Additionally, the compound's properties may be influenced by the presence of functional groups, which can affect its biological activity and interaction with other molecules. Overall, 5-Iodo-7-nitro-1H-indazole is of interest for its potential use in drug development and as a building block in synthetic organic chemistry.
Formula:C7H4IN3O2
InChI:InChI=1S/C7H4IN3O2/c8-5-1-4-3-9-10-7(4)6(2-5)11(12)13/h1-3H,(H,9,10)
InChI key:InChIKey=NXDZVOSGNJYFLG-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(=CC(I)=C1)C=NN2
Synonyms:- 5-Iodo-7-nitro-1H-indazole
- 1H-Indazole, 5-iodo-7-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
