CAS 1167056-54-3
:6-Chloro-4-fluoro-7-methyl-1H-indole
Description:
6-Chloro-4-fluoro-7-methyl-1H-indole is a heterocyclic organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of chlorine and fluorine substituents at the 6 and 4 positions, respectively, along with a methyl group at the 7 position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential reactivity due to the presence of halogen atoms, which can participate in various chemical reactions, including nucleophilic substitutions. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. Additionally, its specific functional groups can influence its interactions with other molecules, affecting its stability and reactivity. Overall, 6-Chloro-4-fluoro-7-methyl-1H-indole is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural features and potential applications.
Formula:C9H7ClFN
InChI:InChI=1S/C9H7ClFN/c1-5-7(10)4-8(11)6-2-3-12-9(5)6/h2-4,12H,1H3
InChI key:InChIKey=DGIBIIOVXBXUIZ-UHFFFAOYSA-N
SMILES:CC1=C2C(=C(F)C=C1Cl)C=CN2
Synonyms:- 1H-Indole, 6-chloro-4-fluoro-7-methyl-
- 6-Chloro-4-fluoro-7-methyl-1H-indole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
