CymitQuimica logo

CAS 1167056-56-5

:

1H-Pyrrolo[2,3-b]pyridin-3-amine, 6-chloro-, hydrochloride (1:1)

Description:
1H-Pyrrolo[2,3-b]pyridin-3-amine, 6-chloro-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. This compound features a chlorine substituent at the 6-position of the pyridine ring and an amino group at the 3-position of the pyrrole moiety. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in polar solvents, particularly water. The presence of the amino group suggests potential basicity, while the chlorine atom may influence its reactivity and interaction with biological targets. This compound is of interest in medicinal chemistry and drug development, often investigated for its potential pharmacological properties. Its specific characteristics, such as melting point, solubility, and spectral data, would be determined through experimental methods. Safety data should also be consulted, as with any chemical substance, to ensure proper handling and usage in laboratory settings.
Formula:C7H6ClN3·ClH
InChI:InChI=1S/C7H6ClN3.ClH/c8-6-2-1-4-5(9)3-10-7(4)11-6;/h1-3H,9H2,(H,10,11);1H
InChI key:InChIKey=IZQUJUOQJBQBJD-UHFFFAOYSA-N
SMILES:NC=1C=2C(NC1)=NC(Cl)=CC2.Cl
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridin-3-amine, 6-chloro-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.