CAS 1167056-57-6
:6-Bromo-4-fluoro-7-methyl-1H-indole
Description:
6-Bromo-4-fluoro-7-methyl-1H-indole is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of bromine and fluorine substituents at the 6 and 4 positions, respectively, along with a methyl group at the 7 position, contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of halogen atoms that can influence biological activity. Additionally, the indole moiety is known for its role in various biological systems, including neurotransmitter function. The compound's synthesis and characterization would involve standard organic chemistry techniques, and its stability may be influenced by the electronic effects of the substituents. Overall, 6-Bromo-4-fluoro-7-methyl-1H-indole represents a versatile scaffold for further chemical modifications and investigations in drug discovery.
Formula:C9H7BrFN
InChI:InChI=1S/C9H7BrFN/c1-5-7(10)4-8(11)6-2-3-12-9(5)6/h2-4,12H,1H3
InChI key:InChIKey=SKWGWBUZBOOZDO-UHFFFAOYSA-N
SMILES:CC1=C2C(=C(F)C=C1Br)C=CN2
Synonyms:- 6-Bromo-4-fluoro-7-methyl-1H-indole
- 1H-Indole, 6-bromo-4-fluoro-7-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
